10.000 TL ve Üzeri Alışverişlerde Kargo Bedava!

Muadil Toner Ricoh Sp-C231/232/242/Sp-C310/320(Siyah)


Baskı Kapasitesi sayfa

1042.58 TL + KDV
Dolar Fiyatı:
32.06 $ + KDV
1251.09 TL
MUADİL TONER RİCOH SP-C231/232/242/SP-C310/320 BK
Sizlere daha iyi hizmet sunulabilmek için site çerezleri kullanmaktayız. Çerezler hakkında detaylı bilgi için Kişisel Verilerin Korunması Kanunu metnini inceleyebilirsiniz